C12H17Br — CID 174819703
1-(1-bromoethyl)-4-ethyl-2,3-dimethylbenzene (PubChem CID 174819703) has the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. Its IUPAC name is 1-(1-bromoethyl)-4-ethyl-2,3-dimethylbenzene.
| Compound Name | 1-(1-bromoethyl)-4-ethyl-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 174819703 |
| Molecular Formula | C12H17Br |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 1-(1-bromoethyl)-4-ethyl-2,3-dimethylbenzene |
| SMILES | CCc1ccc(C(C)Br)c(C)c1C |
| InChI | InChI=1S/C12H17Br/c1-5-11-6-7-12(10(4)13)9(3)8(11)2/h6-7,10H,5H2,1-4H3 |
| InChIKey | RYDFCYJORPNPRP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|