C10H13Cl — CID 141381436
3-chloro-1-ethyl-2,4-dimethylbenzene (PubChem CID 141381436) has the molecular formula C10H13Cl and a molecular weight of 168.67 g/mol. Its IUPAC name is 3-chloro-1-ethyl-2,4-dimethylbenzene.
| Compound Name | 3-chloro-1-ethyl-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 141381436 |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 3-chloro-1-ethyl-2,4-dimethylbenzene |
| SMILES | CCc1ccc(C)c(Cl)c1C |
| InChI | InChI=1S/C10H13Cl/c1-4-9-6-5-7(2)10(11)8(9)3/h5-6H,4H2,1-3H3 |
| InChIKey | PUDDVORAHQVBQZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.67 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |