C11H18ClN — CID 66619297
azane;1-(chloromethyl)-4-ethyl-2,3-dimethylbenzene (PubChem CID 66619297) has the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. Its IUPAC name is azane;1-(chloromethyl)-4-ethyl-2,3-dimethylbenzene.
| Compound Name | azane;1-(chloromethyl)-4-ethyl-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 66619297 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | azane;1-(chloromethyl)-4-ethyl-2,3-dimethylbenzene |
| SMILES | CCc1ccc(CCl)c(C)c1C.N |
| InChI | InChI=1S/C11H15Cl.H3N/c1-4-10-5-6-11(7-12)9(3)8(10)2;/h5-6H,4,7H2,1-3H3;1H3 |
| InChIKey | ICLRFUBWQWKDNA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|