C8H9BrO3 — CID 139940649
4-(1-bromoethyl)benzene-1,2,3-triol (PubChem CID 139940649) has the molecular formula C8H9BrO3 and a molecular weight of 233.06 g/mol. Its IUPAC name is 4-(1-bromoethyl)benzene-1,2,3-triol.
| Compound Name | 4-(1-bromoethyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 139940649 |
| Molecular Formula | C8H9BrO3 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | 4-(1-bromoethyl)benzene-1,2,3-triol |
| SMILES | CC(Br)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C8H9BrO3/c1-4(9)5-2-3-6(10)8(12)7(5)11/h2-4,10-12H,1H3 |
| InChIKey | FPPYMMJWJFWJQG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|