C12H12O7 — CID 174397816
benzene-1,2,3,4-tetrol;benzene-1,3,5-triol (PubChem CID 174397816) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is benzene-1,2,3,4-tetrol;benzene-1,3,5-triol.
| Compound Name | benzene-1,2,3,4-tetrol;benzene-1,3,5-triol |
|---|---|
| PubChem CID | 174397816 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | benzene-1,2,3,4-tetrol;benzene-1,3,5-triol |
| SMILES | Oc1cc(O)cc(O)c1.Oc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C6H6O4.C6H6O3/c7-3-1-2-4(8)6(10)5(3)9;7-4-1-5(8)3-6(9)2-4/h1-2,7-10H;1-3,7-9H |
| InChIKey | BLPALOGJFDWDDE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|