C12H10O6 — CID 141142234
4-(2,3,6-trihydroxyphenyl)benzene-1,2,3-triol (PubChem CID 141142234) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is 4-(2,3,6-trihydroxyphenyl)benzene-1,2,3-triol.
| Compound Name | 4-(2,3,6-trihydroxyphenyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 141142234 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 4-(2,3,6-trihydroxyphenyl)benzene-1,2,3-triol |
| SMILES | Oc1ccc(-c2c(O)ccc(O)c2O)c(O)c1O |
| InChI | InChI=1S/C12H10O6/c13-6-3-4-7(14)11(17)9(6)5-1-2-8(15)12(18)10(5)16/h1-4,13-18H |
| InChIKey | VGPWBPXIFBPEKY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|