C14H14O4 — CID 173290740
4-(4-hydroxy-2,5-dimethylphenyl)benzene-1,2,3-triol (PubChem CID 173290740) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is 4-(4-hydroxy-2,5-dimethylphenyl)benzene-1,2,3-triol.
| Compound Name | 4-(4-hydroxy-2,5-dimethylphenyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 173290740 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 4-(4-hydroxy-2,5-dimethylphenyl)benzene-1,2,3-triol |
| SMILES | Cc1cc(-c2ccc(O)c(O)c2O)c(C)cc1O |
| InChI | InChI=1S/C14H14O4/c1-7-6-12(16)8(2)5-10(7)9-3-4-11(15)14(18)13(9)17/h3-6,15-18H,1-2H3 |
| InChIKey | BMQNYXPEVCSNJI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|