C23H26O4 — CID 157471030
4,6-bis(4-hydroxy-2,5-dimethylphenyl)benzene-1,3-diol;methane (PubChem CID 157471030) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4,6-bis(4-hydroxy-2,5-dimethylphenyl)benzene-1,3-diol;methane.
| Compound Name | 4,6-bis(4-hydroxy-2,5-dimethylphenyl)benzene-1,3-diol;methane |
|---|---|
| PubChem CID | 157471030 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4,6-bis(4-hydroxy-2,5-dimethylphenyl)benzene-1,3-diol;methane |
| SMILES | C.Cc1cc(-c2cc(-c3cc(C)c(O)cc3C)c(O)cc2O)c(C)cc1O |
| InChI | InChI=1S/C22H22O4.CH4/c1-11-7-19(23)13(3)5-15(11)17-9-18(22(26)10-21(17)25)16-6-14(4)20(24)8-12(16)2;/h5-10,23-26H,1-4H3;1H4 |
| InChIKey | BVARYJYPLAIEAG-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |