C46H48O8 — CID 129206149
3,6-bis(4-hydroxy-2,5-dimethylphenyl)-4-methylbenzene-1,2-diol;3,6-bis(4-hydroxy-3,5-dimethylphenyl)-4-methylbenzene-1,2-diol (PubChem CID 129206149) has the molecular formula C46H48O8 and a molecular weight of 728.88 g/mol. Its IUPAC name is 3,6-bis(4-hydroxy-2,5-dimethylphenyl)-4-methylbenzene-1,2-diol;3,6-bis(4-hydroxy-3,5-dimethylphenyl)-4-methylbenzene-1,2-diol.
| Compound Name | 3,6-bis(4-hydroxy-2,5-dimethylphenyl)-4-methylbenzene-1,2-diol;3,6-bis(4-hydroxy-3,5-dimethylphenyl)-4-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 129206149 |
| Molecular Formula | C46H48O8 |
| Molecular Weight | 728.88 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | 3,6-bis(4-hydroxy-2,5-dimethylphenyl)-4-methylbenzene-1,2-diol;3,6-bis(4-hydroxy-3,5-dimethylphenyl)-4-methylbenzene-1,2-diol |
| SMILES | Cc1cc(-c2cc(C)c(-c3cc(C)c(O)c(C)c3)c(O)c2O)cc(C)c1O.Cc1cc(-c2cc(C)c(-c3cc(C)c(O)cc3C)c(O)c2O)c(C)cc1O |
| InChI | InChI=1S/2C23H24O4/c1-11-10-18(16-6-12(2)20(24)13(3)7-16)22(26)23(27)19(11)17-8-14(4)21(25)15(5)9-17;1-11-9-19(24)13(3)6-16(11)18-8-15(5)21(23(27)22(18)26)17-7-14(4)20(25)10-12(17)2/h2*6-10,24-27H,1-5H3 |
| InChIKey | DJDDDUXAUNXBOA-UHFFFAOYSA-N |
| XLogP | 10.77 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.88 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|