C15H16O3 — CID 130228173
5-(4-hydroxy-3,5-dimethylphenyl)-3-methylbenzene-1,2-diol (PubChem CID 130228173) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5-(4-hydroxy-3,5-dimethylphenyl)-3-methylbenzene-1,2-diol.
| Compound Name | 5-(4-hydroxy-3,5-dimethylphenyl)-3-methylbenzene-1,2-diol |
|---|---|
| PubChem CID | 130228173 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5-(4-hydroxy-3,5-dimethylphenyl)-3-methylbenzene-1,2-diol |
| SMILES | Cc1cc(-c2cc(C)c(O)c(O)c2)cc(C)c1O |
| InChI | InChI=1S/C15H16O3/c1-8-4-11(5-9(2)14(8)17)12-6-10(3)15(18)13(16)7-12/h4-7,16-18H,1-3H3 |
| InChIKey | SRJDQFWBUNVZKL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|