C16H20O3 — CID 174407562
ethane;4-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol (PubChem CID 174407562) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is ethane;4-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol.
| Compound Name | ethane;4-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 174407562 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethane;4-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol |
| SMILES | CC.Cc1cc(-c2ccc(O)c(O)c2)cc(C)c1O |
| InChI | InChI=1S/C14H14O3.C2H6/c1-8-5-11(6-9(2)14(8)17)10-3-4-12(15)13(16)7-10;1-2/h3-7,15-17H,1-2H3;1-2H3 |
| InChIKey | IRFPOHISEJSOGW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|