C14H14O3 — CID 101299392
3-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol (PubChem CID 101299392) has the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol.
| Compound Name | 3-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 101299392 |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethylphenyl)benzene-1,2-diol |
| SMILES | Cc1cc(-c2cccc(O)c2O)cc(C)c1O |
| InChI | InChI=1S/C14H14O3/c1-8-6-10(7-9(2)13(8)16)11-4-3-5-12(15)14(11)17/h3-7,15-17H,1-2H3 |
| InChIKey | PJIAODKBPAVHBG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|