C16H18O2 — CID 101302625
3-(3,4-diethylphenyl)benzene-1,2-diol (PubChem CID 101302625) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-(3,4-diethylphenyl)benzene-1,2-diol.
| Compound Name | 3-(3,4-diethylphenyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 101302625 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 3-(3,4-diethylphenyl)benzene-1,2-diol |
| SMILES | CCc1ccc(-c2cccc(O)c2O)cc1CC |
| InChI | InChI=1S/C16H18O2/c1-3-11-8-9-13(10-12(11)4-2)14-6-5-7-15(17)16(14)18/h5-10,17-18H,3-4H2,1-2H3 |
| InChIKey | TWITVVXDTJVJOV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|