C16H18O — CID 21281287
4-(2,6-diethylphenyl)phenol (PubChem CID 21281287) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-(2,6-diethylphenyl)phenol.
| Compound Name | 4-(2,6-diethylphenyl)phenol |
|---|---|
| PubChem CID | 21281287 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 4-(2,6-diethylphenyl)phenol |
| SMILES | CCc1cccc(CC)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C16H18O/c1-3-12-6-5-7-13(4-2)16(12)14-8-10-15(17)11-9-14/h5-11,17H,3-4H2,1-2H3 |
| InChIKey | VRPYSOMDVFTBPV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |