C31H28O6 — CID 23093450
1,5-bis[2-(4-hydroxyphenyl)-3-methoxyphenyl]pentane-2,4-dione (PubChem CID 23093450) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is 1,5-bis[2-(4-hydroxyphenyl)-3-methoxyphenyl]pentane-2,4-dione.
| Compound Name | 1,5-bis[2-(4-hydroxyphenyl)-3-methoxyphenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 23093450 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 1,5-bis[2-(4-hydroxyphenyl)-3-methoxyphenyl]pentane-2,4-dione |
| SMILES | COc1cccc(CC(=O)CC(=O)Cc2cccc(OC)c2-c2ccc(O)cc2)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C31H28O6/c1-36-28-7-3-5-22(30(28)20-9-13-24(32)14-10-20)17-26(34)19-27(35)18-23-6-4-8-29(37-2)31(23)21-11-15-25(33)16-12-21/h3-16,32-33H,17-19H2,1-2H3 |
| InChIKey | FGWGQZIISXMVKS-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|