About 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol
3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol (PubChem CID 59253869) has the molecular formula C18H14O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol.
Molecular Properties
| Compound Name | 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol |
| PubChem CID | 59253869 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol |
| SMILES | Oc1cccc(-c2ccccc2-c2cccc(O)c2O)c1O |
| InChI | InChI=1S/C18H14O4/c19-15-9-3-7-13(17(15)21)11-5-1-2-6-12(11)14-8-4-10-16(20)18(14)22/h1-10,19-22H |
| InChIKey | COVMEMGJEYAJKQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol?
The IUPAC name of 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol (CID 59253869) is 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol.
What is the SMILES notation for 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol?
The canonical SMILES for 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol is Oc1cccc(-c2ccccc2-c2cccc(O)c2O)c1O.
What is the InChIKey of 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol?
The InChIKey is COVMEMGJEYAJKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4/c19-15-9-3-7-13(17(15)21)11-5-1-2-6-12(11)14-8-4-10-16(20)18(14)22/h1-10,19-22H.
What are the key properties of 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol?
3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol has a molecular weight of 294.31 g/mol, XLogP of 3.84, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,3-dihydroxyphenyl)phenyl]benzene-1,2-diol is sourced from PubChem (CID 59253869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).