C7H10O5 — CID 174976921
benzene-1,2,3,4-tetrol;methanol (PubChem CID 174976921) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is benzene-1,2,3,4-tetrol;methanol.
| Compound Name | benzene-1,2,3,4-tetrol;methanol |
|---|---|
| PubChem CID | 174976921 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | benzene-1,2,3,4-tetrol;methanol |
| SMILES | CO.Oc1ccc(O)c(O)c1O |
| InChI | InChI=1S/C6H6O4.CH4O/c7-3-1-2-4(8)6(10)5(3)9;1-2/h1-2,7-10H;2H,1H3 |
| InChIKey | LHRGOLGXCQHJCH-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|