C20H18O2 — CID 175325124
3,4-bis(4-methylphenyl)benzene-1,2-diol (PubChem CID 175325124) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 3,4-bis(4-methylphenyl)benzene-1,2-diol.
| Compound Name | 3,4-bis(4-methylphenyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 175325124 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3,4-bis(4-methylphenyl)benzene-1,2-diol |
| SMILES | Cc1ccc(-c2ccc(O)c(O)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H18O2/c1-13-3-7-15(8-4-13)17-11-12-18(21)20(22)19(17)16-9-5-14(2)6-10-16/h3-12,21-22H,1-2H3 |
| InChIKey | FNDRRCJINWAIPN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|