C14H12Cl4O4 — CID 159491236
1,2-dihydroxyanthracene-9,10-dione;tetrahydrochloride (PubChem CID 159491236) has the molecular formula C14H12Cl4O4 and a molecular weight of 386.06 g/mol. Its IUPAC name is 1,2-dihydroxyanthracene-9,10-dione;tetrahydrochloride.
| Compound Name | 1,2-dihydroxyanthracene-9,10-dione;tetrahydrochloride |
|---|---|
| PubChem CID | 159491236 |
| Molecular Formula | C14H12Cl4O4 |
| Molecular Weight | 386.06 g/mol |
| Exact Mass | 383.95 |
| IUPAC Name | 1,2-dihydroxyanthracene-9,10-dione;tetrahydrochloride |
| SMILES | Cl.Cl.Cl.Cl.O=C1c2ccccc2C(=O)c2c1ccc(O)c2O |
| InChI | InChI=1S/C14H8O4.4ClH/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16;;;;/h1-6,15,18H;4*1H |
| InChIKey | LYFITXAWRFEPEG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.06 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|