C16H14O5 — CID 68974663
1,2-dihydroxyanthracene-9,10-dione;ethanol (PubChem CID 68974663) has the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. Its IUPAC name is 1,2-dihydroxyanthracene-9,10-dione;ethanol.
| Compound Name | 1,2-dihydroxyanthracene-9,10-dione;ethanol |
|---|---|
| PubChem CID | 68974663 |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1,2-dihydroxyanthracene-9,10-dione;ethanol |
| SMILES | CCO.O=C1c2ccccc2C(=O)c2c1ccc(O)c2O |
| InChI | InChI=1S/C14H8O4.C2H6O/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16;1-2-3/h1-6,15,18H;3H,2H2,1H3 |
| InChIKey | XHEYIHUIYPZJEG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|