C14H10O2Se — CID 153490221
1,3-dimethylbenzo[f][2]benzoselenole-4,9-dione (PubChem CID 153490221) has the molecular formula C14H10O2Se and a molecular weight of 289.19 g/mol. Its IUPAC name is 1,3-dimethylbenzo[f][2]benzoselenole-4,9-dione.
| Compound Name | 1,3-dimethylbenzo[f][2]benzoselenole-4,9-dione |
|---|---|
| PubChem CID | 153490221 |
| Molecular Formula | C14H10O2Se |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 1,3-dimethylbenzo[f][2]benzoselenole-4,9-dione |
| SMILES | Cc1[se]c(C)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H10O2Se/c1-7-11-12(8(2)17-7)14(16)10-6-4-3-5-9(10)13(11)15/h3-6H,1-2H3 |
| InChIKey | TVAZXWOWMDDQRC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|