C16H11BrO3 — CID 5182448
1-bromo-4-hydroxy-2,3-dimethylanthracene-9,10-dione (PubChem CID 5182448) has the molecular formula C16H11BrO3 and a molecular weight of 331.17 g/mol. Its IUPAC name is 1-bromo-4-hydroxy-2,3-dimethylanthracene-9,10-dione.
| Compound Name | 1-bromo-4-hydroxy-2,3-dimethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 5182448 |
| Molecular Formula | C16H11BrO3 |
| Molecular Weight | 331.17 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1-bromo-4-hydroxy-2,3-dimethylanthracene-9,10-dione |
| SMILES | Cc1c(C)c(Br)c2c(c1O)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H11BrO3/c1-7-8(2)14(18)12-11(13(7)17)15(19)9-5-3-4-6-10(9)16(12)20/h3-6,18H,1-2H3 |
| InChIKey | HOCSLNDHBCLCQH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.17 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|