C16H12O6S2 — CID 162488178
1,4-dihydroxy-2,3-bis(hydroxysulfanylmethyl)anthracene-9,10-dione (PubChem CID 162488178) has the molecular formula C16H12O6S2 and a molecular weight of 364.40 g/mol. Its IUPAC name is 1,4-dihydroxy-2,3-bis(hydroxysulfanylmethyl)anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-2,3-bis(hydroxysulfanylmethyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 162488178 |
| Molecular Formula | C16H12O6S2 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 1,4-dihydroxy-2,3-bis(hydroxysulfanylmethyl)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(CSO)c(CSO)c(O)c21 |
| InChI | InChI=1S/C16H12O6S2/c17-13-7-3-1-2-4-8(7)14(18)12-11(13)15(19)9(5-23-21)10(6-24-22)16(12)20/h1-4,19-22H,5-6H2 |
| InChIKey | MQNCBOMMFNPIRW-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|