C14H7Cl2NO3 — CID 7731174
1-amino-2,3-dichloro-4-hydroxyanthracene-9,10-dione (PubChem CID 7731174) has the molecular formula C14H7Cl2NO3 and a molecular weight of 308.12 g/mol. Its IUPAC name is 1-amino-2,3-dichloro-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-amino-2,3-dichloro-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 7731174 |
| Molecular Formula | C14H7Cl2NO3 |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 1-amino-2,3-dichloro-4-hydroxyanthracene-9,10-dione |
| SMILES | Nc1c(Cl)c(Cl)c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H7Cl2NO3/c15-9-10(16)14(20)8-7(11(9)17)12(18)5-3-1-2-4-6(5)13(8)19/h1-4,20H,17H2 |
| InChIKey | VUIGYAUPYUWXLR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|