C32H22O10 — CID 53241264
4-[4-(3,4-dihydroxy-9,10-dioxoanthracen-1-yl)oxybutoxy]-1,2-dihydroxyanthracene-9,10-dione (PubChem CID 53241264) has the molecular formula C32H22O10 and a molecular weight of 566.52 g/mol. Its IUPAC name is 4-[4-(3,4-dihydroxy-9,10-dioxoanthracen-1-yl)oxybutoxy]-1,2-dihydroxyanthracene-9,10-dione.
| Compound Name | 4-[4-(3,4-dihydroxy-9,10-dioxoanthracen-1-yl)oxybutoxy]-1,2-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 53241264 |
| Molecular Formula | C32H22O10 |
| Molecular Weight | 566.52 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | 4-[4-(3,4-dihydroxy-9,10-dioxoanthracen-1-yl)oxybutoxy]-1,2-dihydroxyanthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(O)cc(OCCCCOc3cc(O)c(O)c4c3C(=O)c3ccccc3C4=O)c21 |
| InChI | InChI=1S/C32H22O10/c33-19-13-21(23-25(31(19)39)29(37)17-9-3-1-7-15(17)27(23)35)41-11-5-6-12-42-22-14-20(34)32(40)26-24(22)28(36)16-8-2-4-10-18(16)30(26)38/h1-4,7-10,13-14,33-34,39-40H,5-6,11-12H2 |
| InChIKey | PCPGJBMJDUIWEB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|