C24H28O5 — CID 134215182
4-decoxy-1,2-dihydroxyanthracene-9,10-dione (PubChem CID 134215182) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is 4-decoxy-1,2-dihydroxyanthracene-9,10-dione.
| Compound Name | 4-decoxy-1,2-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 134215182 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 4-decoxy-1,2-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCCCCCCCOc1cc(O)c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H28O5/c1-2-3-4-5-6-7-8-11-14-29-19-15-18(25)24(28)21-20(19)22(26)16-12-9-10-13-17(16)23(21)27/h9-10,12-13,15,25,28H,2-8,11,14H2,1H3 |
| InChIKey | HYQGMRXVVFGCSN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|