C19H19NO4 — CID 20695780
1-amino-4-hydroxy-2-pentoxyanthracene-9,10-dione (PubChem CID 20695780) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is 1-amino-4-hydroxy-2-pentoxyanthracene-9,10-dione.
| Compound Name | 1-amino-4-hydroxy-2-pentoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 20695780 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 1-amino-4-hydroxy-2-pentoxyanthracene-9,10-dione |
| SMILES | CCCCCOc1cc(O)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C19H19NO4/c1-2-3-6-9-24-14-10-13(21)15-16(17(14)20)19(23)12-8-5-4-7-11(12)18(15)22/h4-5,7-8,10,21H,2-3,6,9,20H2,1H3 |
| InChIKey | MMZZCPFWVIVEGM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|