C17H15NO5 — CID 57184138
1-amino-4-hydroxy-2-(2-hydroxypropoxy)anthracene-9,10-dione (PubChem CID 57184138) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 1-amino-4-hydroxy-2-(2-hydroxypropoxy)anthracene-9,10-dione.
| Compound Name | 1-amino-4-hydroxy-2-(2-hydroxypropoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 57184138 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-amino-4-hydroxy-2-(2-hydroxypropoxy)anthracene-9,10-dione |
| SMILES | CC(O)COc1cc(O)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H15NO5/c1-8(19)7-23-12-6-11(20)13-14(15(12)18)17(22)10-5-3-2-4-9(10)16(13)21/h2-6,8,19-20H,7,18H2,1H3 |
| InChIKey | DVLYNLUBFCYLSJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|