C21H16ClNO4 — CID 167143627
1-amino-2-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]oxy-4-hydroxyanthracene-9,10-dione (PubChem CID 167143627) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 1-amino-2-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]oxy-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-amino-2-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]oxy-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 167143627 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-amino-2-[(3E,5E)-6-chlorohepta-1,3,5-trien-3-yl]oxy-4-hydroxyanthracene-9,10-dione |
| SMILES | C=C/C(=C\C=C(/C)Cl)Oc1cc(O)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C21H16ClNO4/c1-3-12(9-8-11(2)22)27-16-10-15(24)17-18(19(16)23)21(26)14-7-5-4-6-13(14)20(17)25/h3-10,24H,1,23H2,2H3/b11-8+,12-9+ |
| InChIKey | QZFLAJALLRAWBW-HZOWPXDZSA-N |
| XLogP | 4.34 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|