C31H34N2O4 — CID 123950386
1-amino-4-hydroxy-2-[4-[2-(2,4,4-trimethylhex-5-en-2-ylamino)ethyl]phenoxy]anthracene-9,10-dione (PubChem CID 123950386) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is 1-amino-4-hydroxy-2-[4-[2-(2,4,4-trimethylhex-5-en-2-ylamino)ethyl]phenoxy]anthracene-9,10-dione.
| Compound Name | 1-amino-4-hydroxy-2-[4-[2-(2,4,4-trimethylhex-5-en-2-ylamino)ethyl]phenoxy]anthracene-9,10-dione |
|---|---|
| PubChem CID | 123950386 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 1-amino-4-hydroxy-2-[4-[2-(2,4,4-trimethylhex-5-en-2-ylamino)ethyl]phenoxy]anthracene-9,10-dione |
| SMILES | C=CC(C)(C)CC(C)(C)NCCc1ccc(Oc2cc(O)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C31H34N2O4/c1-6-30(2,3)18-31(4,5)33-16-15-19-11-13-20(14-12-19)37-24-17-23(34)25-26(27(24)32)29(36)22-10-8-7-9-21(22)28(25)35/h6-14,17,33-34H,1,15-16,18,32H2,2-5H3 |
| InChIKey | IYDQACFHZHEMAW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|