C24H29NO4 — CID 90068747
1-amino-2-decoxy-4-hydroxyanthracene-9,10-dione (PubChem CID 90068747) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-amino-2-decoxy-4-hydroxyanthracene-9,10-dione.
| Compound Name | 1-amino-2-decoxy-4-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 90068747 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 1-amino-2-decoxy-4-hydroxyanthracene-9,10-dione |
| SMILES | CCCCCCCCCCOc1cc(O)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C24H29NO4/c1-2-3-4-5-6-7-8-11-14-29-19-15-18(26)20-21(22(19)25)24(28)17-13-10-9-12-16(17)23(20)27/h9-10,12-13,15,26H,2-8,11,14,25H2,1H3 |
| InChIKey | VRBOJBISZYTYCJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|