C27H31NO4 — CID 157277200
1-amino-4-hydroxy-2-(4-propan-2-ylphenoxy)anthracene-9,10-dione;ethane (PubChem CID 157277200) has the molecular formula C27H31NO4 and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-amino-4-hydroxy-2-(4-propan-2-ylphenoxy)anthracene-9,10-dione;ethane.
| Compound Name | 1-amino-4-hydroxy-2-(4-propan-2-ylphenoxy)anthracene-9,10-dione;ethane |
|---|---|
| PubChem CID | 157277200 |
| Molecular Formula | C27H31NO4 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-amino-4-hydroxy-2-(4-propan-2-ylphenoxy)anthracene-9,10-dione;ethane |
| SMILES | CC.CC.CC(C)c1ccc(Oc2cc(O)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H19NO4.2C2H6/c1-12(2)13-7-9-14(10-8-13)28-18-11-17(25)19-20(21(18)24)23(27)16-6-4-3-5-15(16)22(19)26;2*1-2/h3-12,25H,24H2,1-2H3;2*1-2H3 |
| InChIKey | AZFZSLFVWKGCAZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|