C36H27NO4 — CID 59971017
1-amino-4-hydroxy-2-[4-[2-[4-(2-phenylethenyl)phenyl]ethyl]phenoxy]anthracene-9,10-dione (PubChem CID 59971017) has the molecular formula C36H27NO4 and a molecular weight of 537.62 g/mol. Its IUPAC name is 1-amino-4-hydroxy-2-[4-[2-[4-(2-phenylethenyl)phenyl]ethyl]phenoxy]anthracene-9,10-dione.
| Compound Name | 1-amino-4-hydroxy-2-[4-[2-[4-(2-phenylethenyl)phenyl]ethyl]phenoxy]anthracene-9,10-dione |
|---|---|
| PubChem CID | 59971017 |
| Molecular Formula | C36H27NO4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | 1-amino-4-hydroxy-2-[4-[2-[4-(2-phenylethenyl)phenyl]ethyl]phenoxy]anthracene-9,10-dione |
| SMILES | Nc1c(Oc2ccc(CCc3ccc(C=Cc4ccccc4)cc3)cc2)cc(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C36H27NO4/c37-34-31(22-30(38)32-33(34)36(40)29-9-5-4-8-28(29)35(32)39)41-27-20-18-26(19-21-27)17-16-25-14-12-24(13-15-25)11-10-23-6-2-1-3-7-23/h1-15,18-22,38H,16-17,37H2 |
| InChIKey | SLZKBZQBPNHGKZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|