C23H19NO8S — CID 170661278
4-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)oxy-N-(2-methoxyethyl)benzenesulfonamide (PubChem CID 170661278) has the molecular formula C23H19NO8S and a molecular weight of 469.47 g/mol. Its IUPAC name is 4-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)oxy-N-(2-methoxyethyl)benzenesulfonamide.
| Compound Name | 4-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)oxy-N-(2-methoxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 170661278 |
| Molecular Formula | C23H19NO8S |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 4-(1,4-dihydroxy-9,10-dioxoanthracen-2-yl)oxy-N-(2-methoxyethyl)benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(Oc2cc(O)c3c(c2O)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H19NO8S/c1-31-11-10-24-33(29,30)14-8-6-13(7-9-14)32-18-12-17(25)19-20(23(18)28)22(27)16-5-3-2-4-15(16)21(19)26/h2-9,12,24-25,28H,10-11H2,1H3 |
| InChIKey | HUNADMVCAZGIJD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|