C26H29NO7 — CID 134354647
4-[4-hydroxy-1-(4-methoxybutylamino)-9,10-dioxoanthracen-2-yl]oxybutyl prop-2-enoate (PubChem CID 134354647) has the molecular formula C26H29NO7 and a molecular weight of 467.52 g/mol. Its IUPAC name is 4-[4-hydroxy-1-(4-methoxybutylamino)-9,10-dioxoanthracen-2-yl]oxybutyl prop-2-enoate.
| Compound Name | 4-[4-hydroxy-1-(4-methoxybutylamino)-9,10-dioxoanthracen-2-yl]oxybutyl prop-2-enoate |
|---|---|
| PubChem CID | 134354647 |
| Molecular Formula | C26H29NO7 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-[4-hydroxy-1-(4-methoxybutylamino)-9,10-dioxoanthracen-2-yl]oxybutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1cc(O)c2c(c1NCCCCOC)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H29NO7/c1-3-21(29)34-15-9-8-14-33-20-16-19(28)22-23(24(20)27-12-6-7-13-32-2)26(31)18-11-5-4-10-17(18)25(22)30/h3-5,10-11,16,27-28H,1,6-9,12-15H2,2H3 |
| InChIKey | RDPTWAQQQVEZIL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|