C15H19NaO6S — CID 159239707
sodium 2-(6-prop-2-enoyloxyhexoxy)benzenesulfonate (PubChem CID 159239707) has the molecular formula C15H19NaO6S and a molecular weight of 350.37 g/mol. Its IUPAC name is sodium 2-(6-prop-2-enoyloxyhexoxy)benzenesulfonate.
| Compound Name | sodium 2-(6-prop-2-enoyloxyhexoxy)benzenesulfonate |
|---|---|
| PubChem CID | 159239707 |
| Molecular Formula | C15H19NaO6S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | sodium 2-(6-prop-2-enoyloxyhexoxy)benzenesulfonate |
| SMILES | C=CC(=O)OCCCCCCOc1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H20O6S.Na/c1-2-15(16)21-12-8-4-3-7-11-20-13-9-5-6-10-14(13)22(17,18)19;/h2,5-6,9-10H,1,3-4,7-8,11-12H2,(H,17,18,19);/q;+1/p-1 |
| InChIKey | KTXRGDJJFXGMRU-UHFFFAOYSA-M |
| XLogP | -0.74 |
| TPSA | 92.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|