C30H35NO8 — CID 134354642
4-[[4-hydroxy-2-[3-(2-methylprop-2-enoyloxy)propoxy]-9,10-dioxoanthracen-1-yl]amino]butyl 2,2-dimethylpropanoate (PubChem CID 134354642) has the molecular formula C30H35NO8 and a molecular weight of 537.61 g/mol. Its IUPAC name is 4-[[4-hydroxy-2-[3-(2-methylprop-2-enoyloxy)propoxy]-9,10-dioxoanthracen-1-yl]amino]butyl 2,2-dimethylpropanoate.
| Compound Name | 4-[[4-hydroxy-2-[3-(2-methylprop-2-enoyloxy)propoxy]-9,10-dioxoanthracen-1-yl]amino]butyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134354642 |
| Molecular Formula | C30H35NO8 |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 4-[[4-hydroxy-2-[3-(2-methylprop-2-enoyloxy)propoxy]-9,10-dioxoanthracen-1-yl]amino]butyl 2,2-dimethylpropanoate |
| SMILES | C=C(C)C(=O)OCCCOc1cc(O)c2c(c1NCCCCOC(=O)C(C)(C)C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H35NO8/c1-18(2)28(35)38-16-10-15-37-22-17-21(32)23-24(27(34)20-12-7-6-11-19(20)26(23)33)25(22)31-13-8-9-14-39-29(36)30(3,4)5/h6-7,11-12,17,31-32H,1,8-10,13-16H2,2-5H3 |
| InChIKey | QSJLMSFLQJFCQD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|