C22H17NO3 — CID 20693522
1-amino-4-hydroxy-2-[(4-methylphenyl)methyl]anthracene-9,10-dione (PubChem CID 20693522) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is 1-amino-4-hydroxy-2-[(4-methylphenyl)methyl]anthracene-9,10-dione.
| Compound Name | 1-amino-4-hydroxy-2-[(4-methylphenyl)methyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 20693522 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-amino-4-hydroxy-2-[(4-methylphenyl)methyl]anthracene-9,10-dione |
| SMILES | Cc1ccc(Cc2cc(O)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H17NO3/c1-12-6-8-13(9-7-12)10-14-11-17(24)18-19(20(14)23)22(26)16-5-3-2-4-15(16)21(18)25/h2-9,11,24H,10,23H2,1H3 |
| InChIKey | LYJXORJRUMZWHG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|