C16H12BrNO2 — CID 68701733
1-amino-4-bromo-2-ethylanthracene-9,10-dione (PubChem CID 68701733) has the molecular formula C16H12BrNO2 and a molecular weight of 330.18 g/mol. Its IUPAC name is 1-amino-4-bromo-2-ethylanthracene-9,10-dione.
| Compound Name | 1-amino-4-bromo-2-ethylanthracene-9,10-dione |
|---|---|
| PubChem CID | 68701733 |
| Molecular Formula | C16H12BrNO2 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 1-amino-4-bromo-2-ethylanthracene-9,10-dione |
| SMILES | CCc1cc(Br)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H12BrNO2/c1-2-8-7-11(17)12-13(14(8)18)16(20)10-6-4-3-5-9(10)15(12)19/h3-7H,2,18H2,1H3 |
| InChIKey | KUTIJEXPGCAVBG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|