C16H14N2O2S — CID 20695767
1,4-diamino-2-ethylsulfanylanthracene-9,10-dione (PubChem CID 20695767) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 1,4-diamino-2-ethylsulfanylanthracene-9,10-dione.
| Compound Name | 1,4-diamino-2-ethylsulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 20695767 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1,4-diamino-2-ethylsulfanylanthracene-9,10-dione |
| SMILES | CCSc1cc(N)c2c(c1N)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H14N2O2S/c1-2-21-11-7-10(17)12-13(14(11)18)16(20)9-6-4-3-5-8(9)15(12)19/h3-7H,2,17-18H2,1H3 |
| InChIKey | BQDGCUARDJJFFQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|