C22H32N2S4 — CID 19754969
4-[1-[4-amino-3,5-bis(ethylsulfanyl)phenyl]ethyl]-2,6-bis(ethylsulfanyl)aniline (PubChem CID 19754969) has the molecular formula C22H32N2S4 and a molecular weight of 452.78 g/mol. Its IUPAC name is 4-[1-[4-amino-3,5-bis(ethylsulfanyl)phenyl]ethyl]-2,6-bis(ethylsulfanyl)aniline.
| Compound Name | 4-[1-[4-amino-3,5-bis(ethylsulfanyl)phenyl]ethyl]-2,6-bis(ethylsulfanyl)aniline |
|---|---|
| PubChem CID | 19754969 |
| Molecular Formula | C22H32N2S4 |
| Molecular Weight | 452.78 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-[1-[4-amino-3,5-bis(ethylsulfanyl)phenyl]ethyl]-2,6-bis(ethylsulfanyl)aniline |
| SMILES | CCSc1cc(C(C)c2cc(SCC)c(N)c(SCC)c2)cc(SCC)c1N |
| InChI | InChI=1S/C22H32N2S4/c1-6-25-17-10-15(11-18(21(17)23)26-7-2)14(5)16-12-19(27-8-3)22(24)20(13-16)28-9-4/h10-14H,6-9,23-24H2,1-5H3 |
| InChIKey | HMNSOADMBBTZCU-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.78 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|