C14H22S — CID 162469287
1-ethylsulfanyl-3,5-di(propan-2-yl)benzene (PubChem CID 162469287) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 1-ethylsulfanyl-3,5-di(propan-2-yl)benzene.
| Compound Name | 1-ethylsulfanyl-3,5-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 162469287 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 1-ethylsulfanyl-3,5-di(propan-2-yl)benzene |
| SMILES | CCSc1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C14H22S/c1-6-15-14-8-12(10(2)3)7-13(9-14)11(4)5/h7-11H,6H2,1-5H3 |
| InChIKey | BFAAVXBDDRBABE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |