C11H17NS — CID 143252962
2,6-diethyl-4-ethylsulfanylpyridine (PubChem CID 143252962) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 2,6-diethyl-4-ethylsulfanylpyridine.
| Compound Name | 2,6-diethyl-4-ethylsulfanylpyridine |
|---|---|
| PubChem CID | 143252962 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2,6-diethyl-4-ethylsulfanylpyridine |
| SMILES | CCSc1cc(CC)nc(CC)c1 |
| InChI | InChI=1S/C11H17NS/c1-4-9-7-11(13-6-3)8-10(5-2)12-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | SIBXDQVENTZLCM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |