C16H14I4S3 — CID 139623680
5-ethylsulfanyl-2-(4-ethylsulfanyl-2,6-diiodophenyl)sulfanyl-1,3-diiodobenzene (PubChem CID 139623680) has the molecular formula C16H14I4S3 and a molecular weight of 810.10 g/mol. Its IUPAC name is 5-ethylsulfanyl-2-(4-ethylsulfanyl-2,6-diiodophenyl)sulfanyl-1,3-diiodobenzene.
| Compound Name | 5-ethylsulfanyl-2-(4-ethylsulfanyl-2,6-diiodophenyl)sulfanyl-1,3-diiodobenzene |
|---|---|
| PubChem CID | 139623680 |
| Molecular Formula | C16H14I4S3 |
| Molecular Weight | 810.10 g/mol |
| Exact Mass | 809.64 |
| IUPAC Name | 5-ethylsulfanyl-2-(4-ethylsulfanyl-2,6-diiodophenyl)sulfanyl-1,3-diiodobenzene |
| SMILES | CCSc1cc(I)c(Sc2c(I)cc(SCC)cc2I)c(I)c1 |
| InChI | InChI=1S/C16H14I4S3/c1-3-21-9-5-11(17)15(12(18)6-9)23-16-13(19)7-10(22-4-2)8-14(16)20/h5-8H,3-4H2,1-2H3 |
| InChIKey | RDEZABMALYXJMN-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.10 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|