C14H8I6S3 — CID 139623595
1,3,4-triiodo-5-methylsulfanyl-2-(2,3,6-triiodo-4-methylsulfanylphenyl)sulfanylbenzene (PubChem CID 139623595) has the molecular formula C14H8I6S3 and a molecular weight of 1033.84 g/mol. Its IUPAC name is 1,3,4-triiodo-5-methylsulfanyl-2-(2,3,6-triiodo-4-methylsulfanylphenyl)sulfanylbenzene.
| Compound Name | 1,3,4-triiodo-5-methylsulfanyl-2-(2,3,6-triiodo-4-methylsulfanylphenyl)sulfanylbenzene |
|---|---|
| PubChem CID | 139623595 |
| Molecular Formula | C14H8I6S3 |
| Molecular Weight | 1033.84 g/mol |
| Exact Mass | 1033.41 |
| IUPAC Name | 1,3,4-triiodo-5-methylsulfanyl-2-(2,3,6-triiodo-4-methylsulfanylphenyl)sulfanylbenzene |
| SMILES | CSc1cc(I)c(Sc2c(I)cc(SC)c(I)c2I)c(I)c1I |
| InChI | InChI=1S/C14H8I6S3/c1-21-7-3-5(15)13(11(19)9(7)17)23-14-6(16)4-8(22-2)10(18)12(14)20/h3-4H,1-2H3 |
| InChIKey | QWMCOJXUIHQXQY-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.84 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|