About 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene
1-fluoro-3,4-diiodo-2-methylsulfanylbenzene (PubChem CID 131011058) has the molecular formula C7H5FI2S
and a molecular weight of 393.99 g/mol. Its IUPAC name is 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene.
Molecular Properties
| Compound Name | 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene |
| PubChem CID | 131011058 |
| Molecular Formula | C7H5FI2S |
| Molecular Weight | 393.99 g/mol |
| Exact Mass | 393.82 |
| IUPAC Name | 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene |
| SMILES | CSc1c(F)ccc(I)c1I |
| InChI | InChI=1S/C7H5FI2S/c1-11-7-4(8)2-3-5(9)6(7)10/h2-3H,1H3 |
| InChIKey | GOIALNSCOVUNMR-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene?
The IUPAC name of 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene (CID 131011058) is 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene.
What is the SMILES notation for 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene?
The canonical SMILES for 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene is CSc1c(F)ccc(I)c1I.
What is the InChIKey of 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene?
The InChIKey is GOIALNSCOVUNMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FI2S/c1-11-7-4(8)2-3-5(9)6(7)10/h2-3H,1H3.
What are the key properties of 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene?
1-fluoro-3,4-diiodo-2-methylsulfanylbenzene has a molecular weight of 393.99 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3,4-diiodo-2-methylsulfanylbenzene is sourced from PubChem (CID 131011058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).