C7H5ClF2S — CID 119011938
2-chloro-1,4-difluoro-3-methylsulfanylbenzene (PubChem CID 119011938) has the molecular formula C7H5ClF2S and a molecular weight of 194.63 g/mol. Its IUPAC name is 2-chloro-1,4-difluoro-3-methylsulfanylbenzene.
| Compound Name | 2-chloro-1,4-difluoro-3-methylsulfanylbenzene |
|---|---|
| PubChem CID | 119011938 |
| Molecular Formula | C7H5ClF2S |
| Molecular Weight | 194.63 g/mol |
| Exact Mass | 193.98 |
| IUPAC Name | 2-chloro-1,4-difluoro-3-methylsulfanylbenzene |
| SMILES | CSc1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C7H5ClF2S/c1-11-7-5(10)3-2-4(9)6(7)8/h2-3H,1H3 |
| InChIKey | AIYBEMUSVYOLJK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|