C12H10Cl2S2 — CID 155647803
1,4-dichloro-2,3-bis(methylsulfanyl)naphthalene (PubChem CID 155647803) has the molecular formula C12H10Cl2S2 and a molecular weight of 289.25 g/mol. Its IUPAC name is 1,4-dichloro-2,3-bis(methylsulfanyl)naphthalene.
| Compound Name | 1,4-dichloro-2,3-bis(methylsulfanyl)naphthalene |
|---|---|
| PubChem CID | 155647803 |
| Molecular Formula | C12H10Cl2S2 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 1,4-dichloro-2,3-bis(methylsulfanyl)naphthalene |
| SMILES | CSc1c(SC)c(Cl)c2ccccc2c1Cl |
| InChI | InChI=1S/C12H10Cl2S2/c1-15-11-9(13)7-5-3-4-6-8(7)10(14)12(11)16-2/h3-6H,1-2H3 |
| InChIKey | AFZFDCQSEKALHY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |