C11H9ClO2S — CID 163407165
2-chloro-3-methylsulfanylnaphthalene-1,4-diol (PubChem CID 163407165) has the molecular formula C11H9ClO2S and a molecular weight of 240.71 g/mol. Its IUPAC name is 2-chloro-3-methylsulfanylnaphthalene-1,4-diol.
| Compound Name | 2-chloro-3-methylsulfanylnaphthalene-1,4-diol |
|---|---|
| PubChem CID | 163407165 |
| Molecular Formula | C11H9ClO2S |
| Molecular Weight | 240.71 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | 2-chloro-3-methylsulfanylnaphthalene-1,4-diol |
| SMILES | CSc1c(Cl)c(O)c2ccccc2c1O |
| InChI | InChI=1S/C11H9ClO2S/c1-15-11-8(12)9(13)6-4-2-3-5-7(6)10(11)14/h2-5,13-14H,1H3 |
| InChIKey | YYJYJAAPRRQUPR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.71 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|