C16H7Cl3N2O — CID 137098744
6,9,10-trichlorobenzo[a]phenazin-5-ol (PubChem CID 137098744) has the molecular formula C16H7Cl3N2O and a molecular weight of 349.60 g/mol. Its IUPAC name is 6,9,10-trichlorobenzo[a]phenazin-5-ol.
| Compound Name | 6,9,10-trichlorobenzo[a]phenazin-5-ol |
|---|---|
| PubChem CID | 137098744 |
| Molecular Formula | C16H7Cl3N2O |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 6,9,10-trichlorobenzo[a]phenazin-5-ol |
| SMILES | Oc1c(Cl)c2nc3cc(Cl)c(Cl)cc3nc2c2ccccc12 |
| InChI | InChI=1S/C16H7Cl3N2O/c17-9-5-11-12(6-10(9)18)21-15-13(19)16(22)8-4-2-1-3-7(8)14(15)20-11/h1-6,22H |
| InChIKey | LDYBCLILZZWJGJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_6666_A(2)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|